C30H36N4O5 — CID 10697550
8-[1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl]oxy-8-oxooctanoic acid (PubChem CID 10697550) has the molecular formula C30H36N4O5 and a molecular weight of 532.64 g/mol. Its IUPAC name is 8-[1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl]oxy-8-oxooctanoic acid.
| Compound Name | 8-[1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl]oxy-8-oxooctanoic acid |
|---|---|
| PubChem CID | 10697550 |
| Molecular Formula | C30H36N4O5 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | 8-[1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl]oxy-8-oxooctanoic acid |
| SMILES | Cc1c2ccnc(C(=O)NCCN(C)C)c2cc2c3cc(OC(=O)CCCCCCC(=O)O)ccc3n(C)c12 |
| InChI | InChI=1S/C30H36N4O5/c1-19-21-13-14-31-28(30(38)32-15-16-33(2)3)23(21)18-24-22-17-20(11-12-25(22)34(4)29(19)24)39-27(37)10-8-6-5-7-9-26(35)36/h11-14,17-18H,5-10,15-16H2,1-4H3,(H,32,38)(H,35,36) |
| InChIKey | QWDIOUAENMTBHF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|