C10H6BrF9N2O4S2 — CID 10697562
3-bromo-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)benzenesulfonamide (PubChem CID 10697562) has the molecular formula C10H6BrF9N2O4S2 and a molecular weight of 533.19 g/mol. Its IUPAC name is 3-bromo-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)benzenesulfonamide.
| Compound Name | 3-bromo-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 10697562 |
| Molecular Formula | C10H6BrF9N2O4S2 |
| Molecular Weight | 533.19 g/mol |
| Exact Mass | 531.88 |
| IUPAC Name | 3-bromo-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C10H6BrF9N2O4S2/c11-5-3-4(27(21,23)24)1-2-6(5)22-28(25,26)10(19,20)8(14,15)7(12,13)9(16,17)18/h1-3,22H,(H2,21,23,24) |
| InChIKey | HWLCWXCXOCXVFN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.19 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|