C17H30N2O — CID 106975869
(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-(2-propylpyrrolidin-2-yl)methanone (PubChem CID 106975869) has the molecular formula C17H30N2O and a molecular weight of 278.44 g/mol. Its IUPAC name is (4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-(2-propylpyrrolidin-2-yl)methanone.
| Compound Name | (4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-(2-propylpyrrolidin-2-yl)methanone |
|---|---|
| PubChem CID | 106975869 |
| Molecular Formula | C17H30N2O |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | (4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-(2-propylpyrrolidin-2-yl)methanone |
| SMILES | CCCC1(C(=O)N2CC=C(C(C)(C)C)CC2)CCCN1 |
| InChI | InChI=1S/C17H30N2O/c1-5-9-17(10-6-11-18-17)15(20)19-12-7-14(8-13-19)16(2,3)4/h7,18H,5-6,8-13H2,1-4H3 |
| InChIKey | HYFQBSZASZLAQI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|