C13H25NO5S — CID 106977462
1-(2-propan-2-yloxyethylsulfonyl)-2-propylpyrrolidine-2-carboxylic acid (PubChem CID 106977462) has the molecular formula C13H25NO5S and a molecular weight of 307.41 g/mol. Its IUPAC name is 1-(2-propan-2-yloxyethylsulfonyl)-2-propylpyrrolidine-2-carboxylic acid.
| Compound Name | 1-(2-propan-2-yloxyethylsulfonyl)-2-propylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 106977462 |
| Molecular Formula | C13H25NO5S |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 1-(2-propan-2-yloxyethylsulfonyl)-2-propylpyrrolidine-2-carboxylic acid |
| SMILES | CCCC1(C(=O)O)CCCN1S(=O)(=O)CCOC(C)C |
| InChI | InChI=1S/C13H25NO5S/c1-4-6-13(12(15)16)7-5-8-14(13)20(17,18)10-9-19-11(2)3/h11H,4-10H2,1-3H3,(H,15,16) |
| InChIKey | XXMQDXDWVSGEGH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |