C31H34FN5O3 — CID 10697783
1-[1-(2-cyclopentylethyl)-5-(2-fluorophenyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]-3-[4-(dimethylamino)phenyl]urea (PubChem CID 10697783) has the molecular formula C31H34FN5O3 and a molecular weight of 543.64 g/mol. Its IUPAC name is 1-[1-(2-cyclopentylethyl)-5-(2-fluorophenyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]-3-[4-(dimethylamino)phenyl]urea.
| Compound Name | 1-[1-(2-cyclopentylethyl)-5-(2-fluorophenyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]-3-[4-(dimethylamino)phenyl]urea |
|---|---|
| PubChem CID | 10697783 |
| Molecular Formula | C31H34FN5O3 |
| Molecular Weight | 543.64 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | 1-[1-(2-cyclopentylethyl)-5-(2-fluorophenyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]-3-[4-(dimethylamino)phenyl]urea |
| SMILES | CN(C)c1ccc(NC(=O)NC2C(=O)N(CCC3CCCC3)c3ccccc3N(c3ccccc3F)C2=O)cc1 |
| InChI | InChI=1S/C31H34FN5O3/c1-35(2)23-17-15-22(16-18-23)33-31(40)34-28-29(38)36(20-19-21-9-3-4-10-21)26-13-7-8-14-27(26)37(30(28)39)25-12-6-5-11-24(25)32/h5-8,11-18,21,28H,3-4,9-10,19-20H2,1-2H3,(H2,33,34,40) |
| InChIKey | QVNZEPNZNGNPAV-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.64 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|