C23H40N4O7SSi — CID 10697807
1-[(5R,6R,8R,9R)-4-amino-9-[tert-butyl(dimethyl)silyl]oxy-6-(diethylaminomethyl)-2,2-dioxo-1,7-dioxa-2λ6-thiaspiro[4.4]non-3-en-8-yl]-3,5-dimethylpyrimidine-2,4-dione (PubChem CID 10697807) has the molecular formula C23H40N4O7SSi and a molecular weight of 544.75 g/mol. Its IUPAC name is 1-[(5R,6R,8R,9R)-4-amino-9-[tert-butyl(dimethyl)silyl]oxy-6-(diethylaminomethyl)-2,2-dioxo-1,7-dioxa-2λ6-thiaspiro[4.4]non-3-en-8-yl]-3,5-dimethylpyrimidine-2,4-dione.
| Compound Name | 1-[(5R,6R,8R,9R)-4-amino-9-[tert-butyl(dimethyl)silyl]oxy-6-(diethylaminomethyl)-2,2-dioxo-1,7-dioxa-2λ6-thiaspiro[4.4]non-3-en-8-yl]-3,5-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10697807 |
| Molecular Formula | C23H40N4O7SSi |
| Molecular Weight | 544.75 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | 1-[(5R,6R,8R,9R)-4-amino-9-[tert-butyl(dimethyl)silyl]oxy-6-(diethylaminomethyl)-2,2-dioxo-1,7-dioxa-2λ6-thiaspiro[4.4]non-3-en-8-yl]-3,5-dimethylpyrimidine-2,4-dione |
| SMILES | CCN(CC)C[C@H]1O[C@@H](n2cc(C)c(=O)n(C)c2=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@]12OS(=O)(=O)C=C2N |
| InChI | InChI=1S/C23H40N4O7SSi/c1-10-26(11-2)13-17-23(16(24)14-35(30,31)34-23)18(33-36(8,9)22(4,5)6)20(32-17)27-12-15(3)19(28)25(7)21(27)29/h12,14,17-18,20H,10-11,13,24H2,1-9H3/t17-,18+,20-,23-/m1/s1 |
| InChIKey | ZXDXZZCXPNIICD-DNGCBJQESA-N |
| XLogP | 1.38 |
| TPSA | 135.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.75 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|