C18H8O4S8 — CID 10697808
2-(5,8-dihydroxy-[1,3]dithiolo[4,5-b][1,4]benzodithiin-2-ylidene)-[1,3]dithiolo[4,5-b][1,4]benzodithiine-5,8-diol (PubChem CID 10697808) has the molecular formula C18H8O4S8 and a molecular weight of 544.79 g/mol. Its IUPAC name is 2-(5,8-dihydroxy-[1,3]dithiolo[4,5-b][1,4]benzodithiin-2-ylidene)-[1,3]dithiolo[4,5-b][1,4]benzodithiine-5,8-diol.
| Compound Name | 2-(5,8-dihydroxy-[1,3]dithiolo[4,5-b][1,4]benzodithiin-2-ylidene)-[1,3]dithiolo[4,5-b][1,4]benzodithiine-5,8-diol |
|---|---|
| PubChem CID | 10697808 |
| Molecular Formula | C18H8O4S8 |
| Molecular Weight | 544.79 g/mol |
| Exact Mass | 543.82 |
| IUPAC Name | 2-(5,8-dihydroxy-[1,3]dithiolo[4,5-b][1,4]benzodithiin-2-ylidene)-[1,3]dithiolo[4,5-b][1,4]benzodithiine-5,8-diol |
| SMILES | Oc1ccc(O)c2c1SC1=C(SC(=C3SC4=C(S3)Sc3c(O)ccc(O)c3S4)S1)S2 |
| InChI | InChI=1S/C18H8O4S8/c19-5-1-2-6(20)10-9(5)23-13-14(24-10)28-17(27-13)18-29-15-16(30-18)26-12-8(22)4-3-7(21)11(12)25-15/h1-4,19-22H |
| InChIKey | APDZUAHJLYTUGW-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.79 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|