C33H38O7 — CID 10697842
(1S,3S,4S,5R,7S,8S,9R,11R)-11-(2-hydroxyethyl)-5-(2-trityloxyethyl)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecane-4,8-diol (PubChem CID 10697842) has the molecular formula C33H38O7 and a molecular weight of 546.66 g/mol. Its IUPAC name is (1S,3S,4S,5R,7S,8S,9R,11R)-11-(2-hydroxyethyl)-5-(2-trityloxyethyl)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecane-4,8-diol.
| Compound Name | (1S,3S,4S,5R,7S,8S,9R,11R)-11-(2-hydroxyethyl)-5-(2-trityloxyethyl)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecane-4,8-diol |
|---|---|
| PubChem CID | 10697842 |
| Molecular Formula | C33H38O7 |
| Molecular Weight | 546.66 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | (1S,3S,4S,5R,7S,8S,9R,11R)-11-(2-hydroxyethyl)-5-(2-trityloxyethyl)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecane-4,8-diol |
| SMILES | OCC[C@H]1CC[C@@H]2O[C@H]3[C@@H](O)[C@@H](CCOC(c4ccccc4)(c4ccccc4)c4ccccc4)O[C@H]3[C@@H](O)[C@H]2O1 |
| InChI | InChI=1S/C33H38O7/c34-20-18-25-16-17-27-30(38-25)29(36)32-31(40-27)28(35)26(39-32)19-21-37-33(22-10-4-1-5-11-22,23-12-6-2-7-13-23)24-14-8-3-9-15-24/h1-15,25-32,34-36H,16-21H2/t25-,26-,27+,28+,29+,30+,31+,32+/m1/s1 |
| InChIKey | BJMBDPVHSNSQKS-CSZISEPCSA-N |
| XLogP | 3.57 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.66 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|