C31H37N3O4S — CID 10697861
7-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-(3,4-dimethoxyphenyl)-2-pyridin-2-ylsulfanylheptanenitrile (PubChem CID 10697861) has the molecular formula C31H37N3O4S and a molecular weight of 547.72 g/mol. Its IUPAC name is 7-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-(3,4-dimethoxyphenyl)-2-pyridin-2-ylsulfanylheptanenitrile.
| Compound Name | 7-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-(3,4-dimethoxyphenyl)-2-pyridin-2-ylsulfanylheptanenitrile |
|---|---|
| PubChem CID | 10697861 |
| Molecular Formula | C31H37N3O4S |
| Molecular Weight | 547.72 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | 7-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-(3,4-dimethoxyphenyl)-2-pyridin-2-ylsulfanylheptanenitrile |
| SMILES | COc1ccc(C(C#N)(CCCCCN2CCc3cc(OC)c(OC)cc3C2)Sc2ccccn2)cc1OC |
| InChI | InChI=1S/C31H37N3O4S/c1-35-26-12-11-25(20-29(26)38-4)31(22-32,39-30-10-6-8-15-33-30)14-7-5-9-16-34-17-13-23-18-27(36-2)28(37-3)19-24(23)21-34/h6,8,10-12,15,18-20H,5,7,9,13-14,16-17,21H2,1-4H3 |
| InChIKey | HVCQOFNIKZRLKI-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 76.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.72 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|