C8H17N3O — CID 106980734
3-propan-2-ylpyrrolidine-3-carbohydrazide (PubChem CID 106980734) has the molecular formula C8H17N3O and a molecular weight of 171.24 g/mol. Its IUPAC name is 3-propan-2-ylpyrrolidine-3-carbohydrazide.
| Compound Name | 3-propan-2-ylpyrrolidine-3-carbohydrazide |
|---|---|
| PubChem CID | 106980734 |
| Molecular Formula | C8H17N3O |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | 3-propan-2-ylpyrrolidine-3-carbohydrazide |
| SMILES | CC(C)C1(C(=O)NN)CCNC1 |
| InChI | InChI=1S/C8H17N3O/c1-6(2)8(7(12)11-9)3-4-10-5-8/h6,10H,3-5,9H2,1-2H3,(H,11,12) |
| InChIKey | QQWZHLIUNKOFDL-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|