C31H36FN3O4S — CID 10698209
4-[[(2-fluorophenyl)sulfonylamino]methyl]-N-[(1S,2R)-6-methoxy-1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]cyclohexane-1-carboxamide (PubChem CID 10698209) has the molecular formula C31H36FN3O4S and a molecular weight of 565.71 g/mol. Its IUPAC name is 4-[[(2-fluorophenyl)sulfonylamino]methyl]-N-[(1S,2R)-6-methoxy-1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]cyclohexane-1-carboxamide.
| Compound Name | 4-[[(2-fluorophenyl)sulfonylamino]methyl]-N-[(1S,2R)-6-methoxy-1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 10698209 |
| Molecular Formula | C31H36FN3O4S |
| Molecular Weight | 565.71 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | 4-[[(2-fluorophenyl)sulfonylamino]methyl]-N-[(1S,2R)-6-methoxy-1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]cyclohexane-1-carboxamide |
| SMILES | COc1ccc2c(c1)CC[C@@H](NC(=O)C1CCC(CNS(=O)(=O)c3ccccc3F)CC1)[C@H]2Cc1cccnc1 |
| InChI | InChI=1S/C31H36FN3O4S/c1-39-25-13-14-26-24(18-25)12-15-29(27(26)17-22-5-4-16-33-19-22)35-31(36)23-10-8-21(9-11-23)20-34-40(37,38)30-7-3-2-6-28(30)32/h2-7,13-14,16,18-19,21,23,27,29,34H,8-12,15,17,20H2,1H3,(H,35,36)/t21?,23?,27-,29+/m0/s1 |
| InChIKey | NQWFHTOYNNSADF-GPXXFXIISA-N |
| XLogP | 4.77 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.71 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |