C14H27NO3S — CID 106982343
3-tert-butylsulfonyl-1-(3-propan-2-ylpyrrolidin-3-yl)propan-1-one (PubChem CID 106982343) has the molecular formula C14H27NO3S and a molecular weight of 289.44 g/mol. Its IUPAC name is 3-tert-butylsulfonyl-1-(3-propan-2-ylpyrrolidin-3-yl)propan-1-one.
| Compound Name | 3-tert-butylsulfonyl-1-(3-propan-2-ylpyrrolidin-3-yl)propan-1-one |
|---|---|
| PubChem CID | 106982343 |
| Molecular Formula | C14H27NO3S |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 3-tert-butylsulfonyl-1-(3-propan-2-ylpyrrolidin-3-yl)propan-1-one |
| SMILES | CC(C)C1(C(=O)CCS(=O)(=O)C(C)(C)C)CCNC1 |
| InChI | InChI=1S/C14H27NO3S/c1-11(2)14(7-8-15-10-14)12(16)6-9-19(17,18)13(3,4)5/h11,15H,6-10H2,1-5H3 |
| InChIKey | LINOSODVJLHRIJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |