C17H20Br2N2O4S2Si — CID 10698248
(3R)-2-(4,5-dibromothiophen-2-yl)sulfonyl-N-trimethylsilyloxy-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 10698248) has the molecular formula C17H20Br2N2O4S2Si and a molecular weight of 568.39 g/mol. Its IUPAC name is (3R)-2-(4,5-dibromothiophen-2-yl)sulfonyl-N-trimethylsilyloxy-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (3R)-2-(4,5-dibromothiophen-2-yl)sulfonyl-N-trimethylsilyloxy-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 10698248 |
| Molecular Formula | C17H20Br2N2O4S2Si |
| Molecular Weight | 568.39 g/mol |
| Exact Mass | 565.90 |
| IUPAC Name | (3R)-2-(4,5-dibromothiophen-2-yl)sulfonyl-N-trimethylsilyloxy-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | C[Si](C)(C)ONC(=O)[C@H]1Cc2ccccc2CN1S(=O)(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C17H20Br2N2O4S2Si/c1-28(2,3)25-20-17(22)14-8-11-6-4-5-7-12(11)10-21(14)27(23,24)15-9-13(18)16(19)26-15/h4-7,9,14H,8,10H2,1-3H3,(H,20,22)/t14-/m1/s1 |
| InChIKey | DUKVWWQGRJGUPO-CQSZACIVSA-N |
| XLogP | 4.27 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|