C13H26N2O4S — CID 106982897
1-[butyl(methyl)sulfamoyl]-3-propan-2-ylpyrrolidine-3-carboxylic acid (PubChem CID 106982897) has the molecular formula C13H26N2O4S and a molecular weight of 306.43 g/mol. Its IUPAC name is 1-[butyl(methyl)sulfamoyl]-3-propan-2-ylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-[butyl(methyl)sulfamoyl]-3-propan-2-ylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 106982897 |
| Molecular Formula | C13H26N2O4S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 1-[butyl(methyl)sulfamoyl]-3-propan-2-ylpyrrolidine-3-carboxylic acid |
| SMILES | CCCCN(C)S(=O)(=O)N1CCC(C(=O)O)(C(C)C)C1 |
| InChI | InChI=1S/C13H26N2O4S/c1-5-6-8-14(4)20(18,19)15-9-7-13(10-15,11(2)3)12(16)17/h11H,5-10H2,1-4H3,(H,16,17) |
| InChIKey | OKKAFFRYGBXLJE-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |