C18H11Cl7O6 — CID 10698296
2-[5-[1-[5-(carboxymethoxy)-2,4-dichlorophenyl]-2,2,2-trichloroethyl]-2,4-dichlorophenoxy]acetic acid (PubChem CID 10698296) has the molecular formula C18H11Cl7O6 and a molecular weight of 571.45 g/mol. Its IUPAC name is 2-[5-[1-[5-(carboxymethoxy)-2,4-dichlorophenyl]-2,2,2-trichloroethyl]-2,4-dichlorophenoxy]acetic acid.
| Compound Name | 2-[5-[1-[5-(carboxymethoxy)-2,4-dichlorophenyl]-2,2,2-trichloroethyl]-2,4-dichlorophenoxy]acetic acid |
|---|---|
| PubChem CID | 10698296 |
| Molecular Formula | C18H11Cl7O6 |
| Molecular Weight | 571.45 g/mol |
| Exact Mass | 567.84 |
| IUPAC Name | 2-[5-[1-[5-(carboxymethoxy)-2,4-dichlorophenyl]-2,2,2-trichloroethyl]-2,4-dichlorophenoxy]acetic acid |
| SMILES | O=C(O)COc1cc(C(c2cc(OCC(=O)O)c(Cl)cc2Cl)C(Cl)(Cl)Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C18H11Cl7O6/c19-9-3-11(21)13(30-5-15(26)27)1-7(9)17(18(23,24)25)8-2-14(31-6-16(28)29)12(22)4-10(8)20/h1-4,17H,5-6H2,(H,26,27)(H,28,29) |
| InChIKey | WJAGZYZVDCZXLO-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.45 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|