C35H45N3O4 — CID 10698311
(2S,4R)-6-[4-(3-aminophenyl)phenyl]-4-[[(2S)-1-anilino-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl]-2-butylhexanoic acid (PubChem CID 10698311) has the molecular formula C35H45N3O4 and a molecular weight of 571.76 g/mol. Its IUPAC name is (2S,4R)-6-[4-(3-aminophenyl)phenyl]-4-[[(2S)-1-anilino-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl]-2-butylhexanoic acid.
| Compound Name | (2S,4R)-6-[4-(3-aminophenyl)phenyl]-4-[[(2S)-1-anilino-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl]-2-butylhexanoic acid |
|---|---|
| PubChem CID | 10698311 |
| Molecular Formula | C35H45N3O4 |
| Molecular Weight | 571.76 g/mol |
| Exact Mass | 571.34 |
| IUPAC Name | (2S,4R)-6-[4-(3-aminophenyl)phenyl]-4-[[(2S)-1-anilino-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl]-2-butylhexanoic acid |
| SMILES | CCCCC(C[C@@H](CCc1ccc(-c2cccc(N)c2)cc1)C(=O)N[C@H](C(=O)Nc1ccccc1)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C35H45N3O4/c1-5-6-11-28(34(41)42)22-27(21-18-24-16-19-25(20-17-24)26-12-10-13-29(36)23-26)32(39)38-31(35(2,3)4)33(40)37-30-14-8-7-9-15-30/h7-10,12-17,19-20,23,27-28,31H,5-6,11,18,21-22,36H2,1-4H3,(H,37,40)(H,38,39)(H,41,42)/t27-,28?,31-/m1/s1 |
| InChIKey | PMABCPFRGPPVJY-ZYFDBEBBSA-N |
| XLogP | 6.94 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.76 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|