C24H25ClN4O7S2 — CID 10698477
2-(2,6-diethyl-4-phenylpyridin-1-ium-1-yl)-N-(2-sulfamoyl-1,3-benzothiazol-6-yl)acetamide perchlorate (PubChem CID 10698477) has the molecular formula C24H25ClN4O7S2 and a molecular weight of 581.07 g/mol. Its IUPAC name is 2-(2,6-diethyl-4-phenylpyridin-1-ium-1-yl)-N-(2-sulfamoyl-1,3-benzothiazol-6-yl)acetamide perchlorate.
| Compound Name | 2-(2,6-diethyl-4-phenylpyridin-1-ium-1-yl)-N-(2-sulfamoyl-1,3-benzothiazol-6-yl)acetamide perchlorate |
|---|---|
| PubChem CID | 10698477 |
| Molecular Formula | C24H25ClN4O7S2 |
| Molecular Weight | 581.07 g/mol |
| Exact Mass | 580.09 |
| IUPAC Name | 2-(2,6-diethyl-4-phenylpyridin-1-ium-1-yl)-N-(2-sulfamoyl-1,3-benzothiazol-6-yl)acetamide perchlorate |
| SMILES | CCc1cc(-c2ccccc2)cc(CC)[n+]1CC(=O)Nc1ccc2nc(S(N)(=O)=O)sc2c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C24H24N4O3S2.ClHO4/c1-3-19-12-17(16-8-6-5-7-9-16)13-20(4-2)28(19)15-23(29)26-18-10-11-21-22(14-18)32-24(27-21)33(25,30)31;2-1(3,4)5/h5-14H,3-4,15H2,1-2H3,(H2-,25,26,29,30,31);(H,2,3,4,5) |
| InChIKey | ZMIWCRUPNJJWPY-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 198.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.07 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|