C16H22BrNO2 — CID 106984789
1-[(4-bromo-3-methylphenyl)methyl]-3-propan-2-ylpyrrolidine-3-carboxylic acid (PubChem CID 106984789) has the molecular formula C16H22BrNO2 and a molecular weight of 340.26 g/mol. Its IUPAC name is 1-[(4-bromo-3-methylphenyl)methyl]-3-propan-2-ylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-[(4-bromo-3-methylphenyl)methyl]-3-propan-2-ylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 106984789 |
| Molecular Formula | C16H22BrNO2 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 1-[(4-bromo-3-methylphenyl)methyl]-3-propan-2-ylpyrrolidine-3-carboxylic acid |
| SMILES | Cc1cc(CN2CCC(C(=O)O)(C(C)C)C2)ccc1Br |
| InChI | InChI=1S/C16H22BrNO2/c1-11(2)16(15(19)20)6-7-18(10-16)9-13-4-5-14(17)12(3)8-13/h4-5,8,11H,6-7,9-10H2,1-3H3,(H,19,20) |
| InChIKey | ZJNCCRDMFYUOAP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |