C34H36ClN5O2 — CID 10698493
(2S)-N-[(2S)-1-[benzyl(methyl)amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-1-[N'-[(2-chlorophenyl)methyl]carbamimidoyl]pyrrolidine-2-carboxamide (PubChem CID 10698493) has the molecular formula C34H36ClN5O2 and a molecular weight of 582.15 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-[benzyl(methyl)amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-1-[N'-[(2-chlorophenyl)methyl]carbamimidoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2S)-1-[benzyl(methyl)amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-1-[N'-[(2-chlorophenyl)methyl]carbamimidoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 10698493 |
| Molecular Formula | C34H36ClN5O2 |
| Molecular Weight | 582.15 g/mol |
| Exact Mass | 581.26 |
| IUPAC Name | (2S)-N-[(2S)-1-[benzyl(methyl)amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-1-[N'-[(2-chlorophenyl)methyl]carbamimidoyl]pyrrolidine-2-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)[C@H](Cc1ccc2ccccc2c1)NC(=O)[C@@H]1CCCN1/C(N)=N\Cc1ccccc1Cl |
| InChI | InChI=1S/C34H36ClN5O2/c1-39(23-24-10-3-2-4-11-24)33(42)30(21-25-17-18-26-12-5-6-13-27(26)20-25)38-32(41)31-16-9-19-40(31)34(36)37-22-28-14-7-8-15-29(28)35/h2-8,10-15,17-18,20,30-31H,9,16,19,21-23H2,1H3,(H2,36,37)(H,38,41)/t30-,31-/m0/s1 |
| InChIKey | LKIRBVMNNGVMKU-CONSDPRKSA-N |
| XLogP | 5.16 |
| TPSA | 91.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.15 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|