C28H30BrClN4O3 — CID 10698563
1-[(2S)-4-(6-bromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)-2-(2-methoxyethyl)piperazin-1-yl]-2-(1-oxidopyridin-1-ium-4-yl)ethanone (PubChem CID 10698563) has the molecular formula C28H30BrClN4O3 and a molecular weight of 585.93 g/mol. Its IUPAC name is 1-[(2S)-4-(6-bromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)-2-(2-methoxyethyl)piperazin-1-yl]-2-(1-oxidopyridin-1-ium-4-yl)ethanone.
| Compound Name | 1-[(2S)-4-(6-bromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)-2-(2-methoxyethyl)piperazin-1-yl]-2-(1-oxidopyridin-1-ium-4-yl)ethanone |
|---|---|
| PubChem CID | 10698563 |
| Molecular Formula | C28H30BrClN4O3 |
| Molecular Weight | 585.93 g/mol |
| Exact Mass | 584.12 |
| IUPAC Name | 1-[(2S)-4-(6-bromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)-2-(2-methoxyethyl)piperazin-1-yl]-2-(1-oxidopyridin-1-ium-4-yl)ethanone |
| SMILES | COCC[C@H]1CN(C2c3ccc(Cl)cc3CCc3cc(Br)cnc32)CCN1C(=O)Cc1cc[n+]([O-])cc1 |
| InChI | InChI=1S/C28H30BrClN4O3/c1-37-13-8-24-18-32(11-12-34(24)26(35)14-19-6-9-33(36)10-7-19)28-25-5-4-23(30)16-20(25)2-3-21-15-22(29)17-31-27(21)28/h4-7,9-10,15-17,24,28H,2-3,8,11-14,18H2,1H3/t24-,28?/m0/s1 |
| InChIKey | OVQRCNZLFIDOIZ-ZZDYIDRTSA-N |
| XLogP | 4.11 |
| TPSA | 72.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.93 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|