C16H20BrN — CID 106985642
5-bromo-3-(2,2-dimethylcyclohexyl)-1H-indole (PubChem CID 106985642) has the molecular formula C16H20BrN and a molecular weight of 306.25 g/mol. Its IUPAC name is 5-bromo-3-(2,2-dimethylcyclohexyl)-1H-indole.
| Compound Name | 5-bromo-3-(2,2-dimethylcyclohexyl)-1H-indole |
|---|---|
| PubChem CID | 106985642 |
| Molecular Formula | C16H20BrN |
| Molecular Weight | 306.25 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 5-bromo-3-(2,2-dimethylcyclohexyl)-1H-indole |
| SMILES | CC1(C)CCCCC1c1c[nH]c2ccc(Br)cc12 |
| InChI | InChI=1S/C16H20BrN/c1-16(2)8-4-3-5-14(16)13-10-18-15-7-6-11(17)9-12(13)15/h6-7,9-10,14,18H,3-5,8H2,1-2H3 |
| InChIKey | UPNCIUIJWADSPQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.25 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |