About 7-bromo-3-(3,3-dimethylbutan-2-yl)-5-fluoro-1H-indole
7-bromo-3-(3,3-dimethylbutan-2-yl)-5-fluoro-1H-indole (PubChem CID 106985678) has the molecular formula C14H17BrFN
and a molecular weight of 298.20 g/mol. Its IUPAC name is 7-bromo-3-(3,3-dimethylbutan-2-yl)-5-fluoro-1H-indole.
Molecular Properties
| Compound Name | 7-bromo-3-(3,3-dimethylbutan-2-yl)-5-fluoro-1H-indole |
| PubChem CID | 106985678 |
| Molecular Formula | C14H17BrFN |
| Molecular Weight | 298.20 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 7-bromo-3-(3,3-dimethylbutan-2-yl)-5-fluoro-1H-indole |
| SMILES | CC(c1c[nH]c2c(Br)cc(F)cc12)C(C)(C)C |
| InChI | InChI=1S/C14H17BrFN/c1-8(14(2,3)4)11-7-17-13-10(11)5-9(16)6-12(13)15/h5-8,17H,1-4H3 |
| InChIKey | QAKUIEKSZYRLIH-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.20 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 7-bromo-3-(3,3-dimethylbutan-2-yl)-5-fluoro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-3-(3,3-dimethylbutan-2-yl)-5-fluoro-1H-indole?
The IUPAC name of 7-bromo-3-(3,3-dimethylbutan-2-yl)-5-fluoro-1H-indole (CID 106985678) is 7-bromo-3-(3,3-dimethylbutan-2-yl)-5-fluoro-1H-indole.
What is the SMILES notation for 7-bromo-3-(3,3-dimethylbutan-2-yl)-5-fluoro-1H-indole?
The canonical SMILES for 7-bromo-3-(3,3-dimethylbutan-2-yl)-5-fluoro-1H-indole is CC(c1c[nH]c2c(Br)cc(F)cc12)C(C)(C)C.
What is the InChIKey of 7-bromo-3-(3,3-dimethylbutan-2-yl)-5-fluoro-1H-indole?
The InChIKey is QAKUIEKSZYRLIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17BrFN/c1-8(14(2,3)4)11-7-17-13-10(11)5-9(16)6-12(13)15/h5-8,17H,1-4H3.
What are the key properties of 7-bromo-3-(3,3-dimethylbutan-2-yl)-5-fluoro-1H-indole?
7-bromo-3-(3,3-dimethylbutan-2-yl)-5-fluoro-1H-indole has a molecular weight of 298.20 g/mol, XLogP of 5.22, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-3-(3,3-dimethylbutan-2-yl)-5-fluoro-1H-indole is sourced from PubChem (CID 106985678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).