C14H17BrFN — CID 106985678
7-bromo-3-(3,3-dimethylbutan-2-yl)-5-fluoro-1H-indole (PubChem CID 106985678) has the molecular formula C14H17BrFN and a molecular weight of 298.20 g/mol. Its IUPAC name is 7-bromo-3-(3,3-dimethylbutan-2-yl)-5-fluoro-1H-indole.
| Compound Name | 7-bromo-3-(3,3-dimethylbutan-2-yl)-5-fluoro-1H-indole |
|---|---|
| PubChem CID | 106985678 |
| Molecular Formula | C14H17BrFN |
| Molecular Weight | 298.20 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 7-bromo-3-(3,3-dimethylbutan-2-yl)-5-fluoro-1H-indole |
| SMILES | CC(c1c[nH]c2c(Br)cc(F)cc12)C(C)(C)C |
| InChI | InChI=1S/C14H17BrFN/c1-8(14(2,3)4)11-7-17-13-10(11)5-9(16)6-12(13)15/h5-8,17H,1-4H3 |
| InChIKey | QAKUIEKSZYRLIH-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.20 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |