C13H18ClN — CID 106985918
7-chloro-3-pentan-3-yl-2,3-dihydro-1H-indole (PubChem CID 106985918) has the molecular formula C13H18ClN and a molecular weight of 223.75 g/mol. Its IUPAC name is 7-chloro-3-pentan-3-yl-2,3-dihydro-1H-indole.
| Compound Name | 7-chloro-3-pentan-3-yl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 106985918 |
| Molecular Formula | C13H18ClN |
| Molecular Weight | 223.75 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 7-chloro-3-pentan-3-yl-2,3-dihydro-1H-indole |
| SMILES | CCC(CC)C1CNc2c(Cl)cccc21 |
| InChI | InChI=1S/C13H18ClN/c1-3-9(4-2)11-8-15-13-10(11)6-5-7-12(13)14/h5-7,9,11,15H,3-4,8H2,1-2H3 |
| InChIKey | FYCWLAIGKRLXGI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.75 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |