About 7-methyl-3-nonyl-2,3-dihydro-1H-indole
7-methyl-3-nonyl-2,3-dihydro-1H-indole (PubChem CID 106986257) has the molecular formula C18H29N
and a molecular weight of 259.44 g/mol. Its IUPAC name is 7-methyl-3-nonyl-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 7-methyl-3-nonyl-2,3-dihydro-1H-indole |
| PubChem CID | 106986257 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | 7-methyl-3-nonyl-2,3-dihydro-1H-indole |
| SMILES | CCCCCCCCCC1CNc2c(C)cccc21 |
| InChI | InChI=1S/C18H29N/c1-3-4-5-6-7-8-9-12-16-14-19-18-15(2)11-10-13-17(16)18/h10-11,13,16,19H,3-9,12,14H2,1-2H3 |
| InChIKey | JAVZYOVQGSSIAJ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-methyl-3-nonyl-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-3-nonyl-2,3-dihydro-1H-indole?
The IUPAC name of 7-methyl-3-nonyl-2,3-dihydro-1H-indole (CID 106986257) is 7-methyl-3-nonyl-2,3-dihydro-1H-indole.
What is the SMILES notation for 7-methyl-3-nonyl-2,3-dihydro-1H-indole?
The canonical SMILES for 7-methyl-3-nonyl-2,3-dihydro-1H-indole is CCCCCCCCCC1CNc2c(C)cccc21.
What is the InChIKey of 7-methyl-3-nonyl-2,3-dihydro-1H-indole?
The InChIKey is JAVZYOVQGSSIAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29N/c1-3-4-5-6-7-8-9-12-16-14-19-18-15(2)11-10-13-17(16)18/h10-11,13,16,19H,3-9,12,14H2,1-2H3.
What are the key properties of 7-methyl-3-nonyl-2,3-dihydro-1H-indole?
7-methyl-3-nonyl-2,3-dihydro-1H-indole has a molecular weight of 259.44 g/mol, XLogP of 5.64, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-3-nonyl-2,3-dihydro-1H-indole is sourced from PubChem (CID 106986257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).