About 5-bromo-3-pent-3-ynyl-2,3-dihydro-1H-indole
5-bromo-3-pent-3-ynyl-2,3-dihydro-1H-indole (PubChem CID 106986488) has the molecular formula C13H14BrN
and a molecular weight of 264.17 g/mol. Its IUPAC name is 5-bromo-3-pent-3-ynyl-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 5-bromo-3-pent-3-ynyl-2,3-dihydro-1H-indole |
| PubChem CID | 106986488 |
| Molecular Formula | C13H14BrN |
| Molecular Weight | 264.17 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | 5-bromo-3-pent-3-ynyl-2,3-dihydro-1H-indole |
| SMILES | CC#CCCC1CNc2ccc(Br)cc21 |
| InChI | InChI=1S/C13H14BrN/c1-2-3-4-5-10-9-15-13-7-6-11(14)8-12(10)13/h6-8,10,15H,4-5,9H2,1H3 |
| InChIKey | DZMUTJCNSIVURU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.17 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-3-pent-3-ynyl-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-pent-3-ynyl-2,3-dihydro-1H-indole?
The IUPAC name of 5-bromo-3-pent-3-ynyl-2,3-dihydro-1H-indole (CID 106986488) is 5-bromo-3-pent-3-ynyl-2,3-dihydro-1H-indole.
What is the SMILES notation for 5-bromo-3-pent-3-ynyl-2,3-dihydro-1H-indole?
The canonical SMILES for 5-bromo-3-pent-3-ynyl-2,3-dihydro-1H-indole is CC#CCCC1CNc2ccc(Br)cc21.
What is the InChIKey of 5-bromo-3-pent-3-ynyl-2,3-dihydro-1H-indole?
The InChIKey is DZMUTJCNSIVURU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14BrN/c1-2-3-4-5-10-9-15-13-7-6-11(14)8-12(10)13/h6-8,10,15H,4-5,9H2,1H3.
What are the key properties of 5-bromo-3-pent-3-ynyl-2,3-dihydro-1H-indole?
5-bromo-3-pent-3-ynyl-2,3-dihydro-1H-indole has a molecular weight of 264.17 g/mol, XLogP of 3.76, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-pent-3-ynyl-2,3-dihydro-1H-indole is sourced from PubChem (CID 106986488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).