About 2-methyl-4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]butanoic acid
2-methyl-4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]butanoic acid (PubChem CID 10698650) has the molecular formula C37H32N2O4
and a molecular weight of 568.67 g/mol. Its IUPAC name is 2-methyl-4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]butanoic acid.
Molecular Properties
| Compound Name | 2-methyl-4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]butanoic acid |
| PubChem CID | 10698650 |
| Molecular Formula | C37H32N2O4 |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | 2-methyl-4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]butanoic acid |
| SMILES | CC(CC(c1ccc(OCc2ccc3ccccc3n2)cc1)c1ccc(OCc2ccc3ccccc3n2)cc1)C(=O)O |
| InChI | InChI=1S/C37H32N2O4/c1-25(37(40)41)22-34(26-12-18-32(19-13-26)42-23-30-16-10-28-6-2-4-8-35(28)38-30)27-14-20-33(21-15-27)43-24-31-17-11-29-7-3-5-9-36(29)39-31/h2-21,25,34H,22-24H2,1H3,(H,40,41) |
| InChIKey | ACYVXXNWHUCEEM-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]butanoic acid?
The IUPAC name of 2-methyl-4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]butanoic acid (CID 10698650) is 2-methyl-4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]butanoic acid.
What is the SMILES notation for 2-methyl-4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]butanoic acid?
The canonical SMILES for 2-methyl-4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]butanoic acid is CC(CC(c1ccc(OCc2ccc3ccccc3n2)cc1)c1ccc(OCc2ccc3ccccc3n2)cc1)C(=O)O.
What is the InChIKey of 2-methyl-4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]butanoic acid?
The InChIKey is ACYVXXNWHUCEEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H32N2O4/c1-25(37(40)41)22-34(26-12-18-32(19-13-26)42-23-30-16-10-28-6-2-4-8-35(28)38-30)27-14-20-33(21-15-27)43-24-31-17-11-29-7-3-5-9-36(29)39-31/h2-21,25,34H,22-24H2,1H3,(H,40,41).
What are the key properties of 2-methyl-4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]butanoic acid?
2-methyl-4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]butanoic acid has a molecular weight of 568.67 g/mol, XLogP of 8.18, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]butanoic acid is sourced from PubChem (CID 10698650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).