About 3-cyclopropyl-5,7-difluoro-1,3-dihydroindol-2-one
3-cyclopropyl-5,7-difluoro-1,3-dihydroindol-2-one (PubChem CID 106986568) has the molecular formula C11H9F2NO
and a molecular weight of 209.19 g/mol. Its IUPAC name is 3-cyclopropyl-5,7-difluoro-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 3-cyclopropyl-5,7-difluoro-1,3-dihydroindol-2-one |
| PubChem CID | 106986568 |
| Molecular Formula | C11H9F2NO |
| Molecular Weight | 209.19 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 3-cyclopropyl-5,7-difluoro-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2c(F)cc(F)cc2C1C1CC1 |
| InChI | InChI=1S/C11H9F2NO/c12-6-3-7-9(5-1-2-5)11(15)14-10(7)8(13)4-6/h3-5,9H,1-2H2,(H,14,15) |
| InChIKey | LWDUDJPXFZWMFW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.19 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-cyclopropyl-5,7-difluoro-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-5,7-difluoro-1,3-dihydroindol-2-one?
The IUPAC name of 3-cyclopropyl-5,7-difluoro-1,3-dihydroindol-2-one (CID 106986568) is 3-cyclopropyl-5,7-difluoro-1,3-dihydroindol-2-one.
What is the SMILES notation for 3-cyclopropyl-5,7-difluoro-1,3-dihydroindol-2-one?
The canonical SMILES for 3-cyclopropyl-5,7-difluoro-1,3-dihydroindol-2-one is O=C1Nc2c(F)cc(F)cc2C1C1CC1.
What is the InChIKey of 3-cyclopropyl-5,7-difluoro-1,3-dihydroindol-2-one?
The InChIKey is LWDUDJPXFZWMFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F2NO/c12-6-3-7-9(5-1-2-5)11(15)14-10(7)8(13)4-6/h3-5,9H,1-2H2,(H,14,15).
What are the key properties of 3-cyclopropyl-5,7-difluoro-1,3-dihydroindol-2-one?
3-cyclopropyl-5,7-difluoro-1,3-dihydroindol-2-one has a molecular weight of 209.19 g/mol, XLogP of 2.41, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-5,7-difluoro-1,3-dihydroindol-2-one is sourced from PubChem (CID 106986568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).