C24H19F3NO4+ — CID 10698670
(2,3,6-trifluorophenyl) 1,6-dimethoxy-4,10-dimethylacridin-10-ium-9-carboxylate (PubChem CID 10698670) has the molecular formula C24H19F3NO4+ and a molecular weight of 442.41 g/mol. Its IUPAC name is (2,3,6-trifluorophenyl) 1,6-dimethoxy-4,10-dimethylacridin-10-ium-9-carboxylate.
| Compound Name | (2,3,6-trifluorophenyl) 1,6-dimethoxy-4,10-dimethylacridin-10-ium-9-carboxylate |
|---|---|
| PubChem CID | 10698670 |
| Molecular Formula | C24H19F3NO4+ |
| Molecular Weight | 442.41 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | (2,3,6-trifluorophenyl) 1,6-dimethoxy-4,10-dimethylacridin-10-ium-9-carboxylate |
| SMILES | COc1ccc2c(C(=O)Oc3c(F)ccc(F)c3F)c3c(OC)ccc(C)c3[n+](C)c2c1 |
| InChI | InChI=1S/C24H19F3NO4/c1-12-5-10-18(31-4)20-19(24(29)32-23-16(26)9-8-15(25)21(23)27)14-7-6-13(30-3)11-17(14)28(2)22(12)20/h5-11H,1-4H3/q+1 |
| InChIKey | JVXMLBGOJFDHTP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 48.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.41 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|