C36H41N3O5 — CID 10698746
2-[[(2R)-1-[16-(1-adamantylmethylcarbamoyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl]pyrrolidine-2-carbonyl]amino]acetic acid (PubChem CID 10698746) has the molecular formula C36H41N3O5 and a molecular weight of 595.74 g/mol. Its IUPAC name is 2-[[(2R)-1-[16-(1-adamantylmethylcarbamoyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl]pyrrolidine-2-carbonyl]amino]acetic acid.
| Compound Name | 2-[[(2R)-1-[16-(1-adamantylmethylcarbamoyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl]pyrrolidine-2-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 10698746 |
| Molecular Formula | C36H41N3O5 |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.30 |
| IUPAC Name | 2-[[(2R)-1-[16-(1-adamantylmethylcarbamoyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl]pyrrolidine-2-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)[C@H]1CCCN1C(=O)C1C2c3ccccc3C(c3ccccc32)C1C(=O)NCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C36H41N3O5/c40-28(41)18-37-33(42)27-10-5-11-39(27)35(44)32-30-25-8-3-1-6-23(25)29(24-7-2-4-9-26(24)30)31(32)34(43)38-19-36-15-20-12-21(16-36)14-22(13-20)17-36/h1-4,6-9,20-22,27,29-32H,5,10-19H2,(H,37,42)(H,38,43)(H,40,41)/t20?,21?,22?,27-,29?,30?,31?,32?,36?/m1/s1 |
| InChIKey | RRIOZKGLISHEDX-SEFCCOMFSA-N |
| XLogP | 4.03 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |