C12H17NO6 — CID 106988326
3-[2-hydroxy-3-(2-methoxyethoxy)propoxy]pyridine-4-carboxylic acid (PubChem CID 106988326) has the molecular formula C12H17NO6 and a molecular weight of 271.27 g/mol. Its IUPAC name is 3-[2-hydroxy-3-(2-methoxyethoxy)propoxy]pyridine-4-carboxylic acid.
| Compound Name | 3-[2-hydroxy-3-(2-methoxyethoxy)propoxy]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 106988326 |
| Molecular Formula | C12H17NO6 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 3-[2-hydroxy-3-(2-methoxyethoxy)propoxy]pyridine-4-carboxylic acid |
| SMILES | COCCOCC(O)COc1cnccc1C(=O)O |
| InChI | InChI=1S/C12H17NO6/c1-17-4-5-18-7-9(14)8-19-11-6-13-3-2-10(11)12(15)16/h2-3,6,9,14H,4-5,7-8H2,1H3,(H,15,16) |
| InChIKey | DGRAYKGIFVTMRR-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 98.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|