C14H7Cl2NO2S — CID 106988454
5,8-dichloro-2-thiophen-2-ylquinoline-4-carboxylic acid (PubChem CID 106988454) has the molecular formula C14H7Cl2NO2S and a molecular weight of 324.19 g/mol. Its IUPAC name is 5,8-dichloro-2-thiophen-2-ylquinoline-4-carboxylic acid.
| Compound Name | 5,8-dichloro-2-thiophen-2-ylquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 106988454 |
| Molecular Formula | C14H7Cl2NO2S |
| Molecular Weight | 324.19 g/mol |
| Exact Mass | 322.96 |
| IUPAC Name | 5,8-dichloro-2-thiophen-2-ylquinoline-4-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2cccs2)nc2c(Cl)ccc(Cl)c12 |
| InChI | InChI=1S/C14H7Cl2NO2S/c15-8-3-4-9(16)13-12(8)7(14(18)19)6-10(17-13)11-2-1-5-20-11/h1-6H,(H,18,19) |
| InChIKey | VLLTXQDMOAAWRQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.19 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |