C11H9Cl2NO4S — CID 106988843
4,7-dichloro-1-(2-methylsulfonylethyl)indole-2,3-dione (PubChem CID 106988843) has the molecular formula C11H9Cl2NO4S and a molecular weight of 322.17 g/mol. Its IUPAC name is 4,7-dichloro-1-(2-methylsulfonylethyl)indole-2,3-dione.
| Compound Name | 4,7-dichloro-1-(2-methylsulfonylethyl)indole-2,3-dione |
|---|---|
| PubChem CID | 106988843 |
| Molecular Formula | C11H9Cl2NO4S |
| Molecular Weight | 322.17 g/mol |
| Exact Mass | 320.96 |
| IUPAC Name | 4,7-dichloro-1-(2-methylsulfonylethyl)indole-2,3-dione |
| SMILES | CS(=O)(=O)CCN1C(=O)C(=O)c2c(Cl)ccc(Cl)c21 |
| InChI | InChI=1S/C11H9Cl2NO4S/c1-19(17,18)5-4-14-9-7(13)3-2-6(12)8(9)10(15)11(14)16/h2-3H,4-5H2,1H3 |
| InChIKey | OSXZKZOFEWKCPL-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.17 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|