C25H19F6NO6S2 — CID 10698929
[2-[(6aR)-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-yl]-3-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate (PubChem CID 10698929) has the molecular formula C25H19F6NO6S2 and a molecular weight of 607.55 g/mol. Its IUPAC name is [2-[(6aR)-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-yl]-3-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate.
| Compound Name | [2-[(6aR)-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-yl]-3-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10698929 |
| Molecular Formula | C25H19F6NO6S2 |
| Molecular Weight | 607.55 g/mol |
| Exact Mass | 607.06 |
| IUPAC Name | [2-[(6aR)-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-yl]-3-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate |
| SMILES | CN1CCc2cccc3c2[C@H]1Cc1cccc(-c2c(OS(=O)(=O)C(F)(F)F)cccc2OS(=O)(=O)C(F)(F)F)c1-3 |
| InChI | InChI=1S/C25H19F6NO6S2/c1-32-12-11-14-5-2-7-16-21-15(13-18(32)22(14)16)6-3-8-17(21)23-19(37-39(33,34)24(26,27)28)9-4-10-20(23)38-40(35,36)25(29,30)31/h2-10,18H,11-13H2,1H3/t18-/m1/s1 |
| InChIKey | PNFSZBQKXYOEES-GOSISDBHSA-N |
| XLogP | 5.56 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.55 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|