C13H29NO4 — CID 106990049
3-[[[2-hydroxy-3-(1-methoxypropan-2-yloxy)propyl]amino]methyl]pentan-3-ol (PubChem CID 106990049) has the molecular formula C13H29NO4 and a molecular weight of 263.38 g/mol. Its IUPAC name is 3-[[[2-hydroxy-3-(1-methoxypropan-2-yloxy)propyl]amino]methyl]pentan-3-ol.
| Compound Name | 3-[[[2-hydroxy-3-(1-methoxypropan-2-yloxy)propyl]amino]methyl]pentan-3-ol |
|---|---|
| PubChem CID | 106990049 |
| Molecular Formula | C13H29NO4 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.21 |
| IUPAC Name | 3-[[[2-hydroxy-3-(1-methoxypropan-2-yloxy)propyl]amino]methyl]pentan-3-ol |
| SMILES | CCC(O)(CC)CNCC(O)COC(C)COC |
| InChI | InChI=1S/C13H29NO4/c1-5-13(16,6-2)10-14-7-12(15)9-18-11(3)8-17-4/h11-12,14-16H,5-10H2,1-4H3 |
| InChIKey | OBDQYXSDUSILLA-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |