C15H31NO4 — CID 106990396
1-[[1-(hydroxymethyl)cyclohexyl]methylamino]-3-(1-methoxypropan-2-yloxy)propan-2-ol (PubChem CID 106990396) has the molecular formula C15H31NO4 and a molecular weight of 289.42 g/mol. Its IUPAC name is 1-[[1-(hydroxymethyl)cyclohexyl]methylamino]-3-(1-methoxypropan-2-yloxy)propan-2-ol.
| Compound Name | 1-[[1-(hydroxymethyl)cyclohexyl]methylamino]-3-(1-methoxypropan-2-yloxy)propan-2-ol |
|---|---|
| PubChem CID | 106990396 |
| Molecular Formula | C15H31NO4 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.23 |
| IUPAC Name | 1-[[1-(hydroxymethyl)cyclohexyl]methylamino]-3-(1-methoxypropan-2-yloxy)propan-2-ol |
| SMILES | COCC(C)OCC(O)CNCC1(CO)CCCCC1 |
| InChI | InChI=1S/C15H31NO4/c1-13(9-19-2)20-10-14(18)8-16-11-15(12-17)6-4-3-5-7-15/h13-14,16-18H,3-12H2,1-2H3 |
| InChIKey | IIAYRUQGQDCANW-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |