C25H21ClN4O9S2 — CID 10699109
[3-[[3-[(4-chloro-3-methyl-1,2-oxazol-5-yl)sulfamoyl]thiophene-2-carbonyl]amino]-2,4,6-trimethylphenyl] (4-nitrophenyl) carbonate (PubChem CID 10699109) has the molecular formula C25H21ClN4O9S2 and a molecular weight of 621.05 g/mol. Its IUPAC name is [3-[[3-[(4-chloro-3-methyl-1,2-oxazol-5-yl)sulfamoyl]thiophene-2-carbonyl]amino]-2,4,6-trimethylphenyl] (4-nitrophenyl) carbonate.
| Compound Name | [3-[[3-[(4-chloro-3-methyl-1,2-oxazol-5-yl)sulfamoyl]thiophene-2-carbonyl]amino]-2,4,6-trimethylphenyl] (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 10699109 |
| Molecular Formula | C25H21ClN4O9S2 |
| Molecular Weight | 621.05 g/mol |
| Exact Mass | 620.04 |
| IUPAC Name | [3-[[3-[(4-chloro-3-methyl-1,2-oxazol-5-yl)sulfamoyl]thiophene-2-carbonyl]amino]-2,4,6-trimethylphenyl] (4-nitrophenyl) carbonate |
| SMILES | Cc1cc(C)c(OC(=O)Oc2ccc([N+](=O)[O-])cc2)c(C)c1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl |
| InChI | InChI=1S/C25H21ClN4O9S2/c1-12-11-13(2)21(38-25(32)37-17-7-5-16(6-8-17)30(33)34)14(3)20(12)27-23(31)22-18(9-10-40-22)41(35,36)29-24-19(26)15(4)28-39-24/h5-11,29H,1-4H3,(H,27,31) |
| InChIKey | PVZFVYMGMIHVCA-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 179.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.05 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|