C15H29NO5 — CID 106991436
1-[2-hydroxy-3-(2-methoxyethoxy)propyl]-3-propylpiperidine-3-carboxylic acid (PubChem CID 106991436) has the molecular formula C15H29NO5 and a molecular weight of 303.40 g/mol. Its IUPAC name is 1-[2-hydroxy-3-(2-methoxyethoxy)propyl]-3-propylpiperidine-3-carboxylic acid.
| Compound Name | 1-[2-hydroxy-3-(2-methoxyethoxy)propyl]-3-propylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 106991436 |
| Molecular Formula | C15H29NO5 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | 1-[2-hydroxy-3-(2-methoxyethoxy)propyl]-3-propylpiperidine-3-carboxylic acid |
| SMILES | CCCC1(C(=O)O)CCCN(CC(O)COCCOC)C1 |
| InChI | InChI=1S/C15H29NO5/c1-3-5-15(14(18)19)6-4-7-16(12-15)10-13(17)11-21-9-8-20-2/h13,17H,3-12H2,1-2H3,(H,18,19) |
| InChIKey | IYKHWNILKVKNES-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|