C14H30N2O3 — CID 106992140
1-[(1-ethylpyrrolidin-2-yl)methyl-methylamino]-3-(2-methoxyethoxy)propan-2-ol (PubChem CID 106992140) has the molecular formula C14H30N2O3 and a molecular weight of 274.40 g/mol. Its IUPAC name is 1-[(1-ethylpyrrolidin-2-yl)methyl-methylamino]-3-(2-methoxyethoxy)propan-2-ol.
| Compound Name | 1-[(1-ethylpyrrolidin-2-yl)methyl-methylamino]-3-(2-methoxyethoxy)propan-2-ol |
|---|---|
| PubChem CID | 106992140 |
| Molecular Formula | C14H30N2O3 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | 1-[(1-ethylpyrrolidin-2-yl)methyl-methylamino]-3-(2-methoxyethoxy)propan-2-ol |
| SMILES | CCN1CCCC1CN(C)CC(O)COCCOC |
| InChI | InChI=1S/C14H30N2O3/c1-4-16-7-5-6-13(16)10-15(2)11-14(17)12-19-9-8-18-3/h13-14,17H,4-12H2,1-3H3 |
| InChIKey | IRTXVNPPPBHIAU-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|