C10H22O4 — CID 106992811
1-(2-methoxyethoxy)heptane-2,5-diol (PubChem CID 106992811) has the molecular formula C10H22O4 and a molecular weight of 206.28 g/mol. Its IUPAC name is 1-(2-methoxyethoxy)heptane-2,5-diol.
| Compound Name | 1-(2-methoxyethoxy)heptane-2,5-diol |
|---|---|
| PubChem CID | 106992811 |
| Molecular Formula | C10H22O4 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 1-(2-methoxyethoxy)heptane-2,5-diol |
| SMILES | CCC(O)CCC(O)COCCOC |
| InChI | InChI=1S/C10H22O4/c1-3-9(11)4-5-10(12)8-14-7-6-13-2/h9-12H,3-8H2,1-2H3 |
| InChIKey | RAWTZHLQTAACCL-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|