C14H28N2O5 — CID 106992894
methyl 3-[4-[2-hydroxy-3-(2-methoxyethoxy)propyl]piperazin-1-yl]propanoate (PubChem CID 106992894) has the molecular formula C14H28N2O5 and a molecular weight of 304.39 g/mol. Its IUPAC name is methyl 3-[4-[2-hydroxy-3-(2-methoxyethoxy)propyl]piperazin-1-yl]propanoate.
| Compound Name | methyl 3-[4-[2-hydroxy-3-(2-methoxyethoxy)propyl]piperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 106992894 |
| Molecular Formula | C14H28N2O5 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | methyl 3-[4-[2-hydroxy-3-(2-methoxyethoxy)propyl]piperazin-1-yl]propanoate |
| SMILES | COCCOCC(O)CN1CCN(CCC(=O)OC)CC1 |
| InChI | InChI=1S/C14H28N2O5/c1-19-9-10-21-12-13(17)11-16-7-5-15(6-8-16)4-3-14(18)20-2/h13,17H,3-12H2,1-2H3 |
| InChIKey | IAHGDAGPRBYYIA-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|