C13H11Cl2N3O2S — CID 106993392
4-[(2,6-dichloro-3-pyridinyl)methylsulfanyl]-2,6-dimethylpyrimidine-5-carboxylic acid (PubChem CID 106993392) has the molecular formula C13H11Cl2N3O2S and a molecular weight of 344.22 g/mol. Its IUPAC name is 4-[(2,6-dichloro-3-pyridinyl)methylsulfanyl]-2,6-dimethylpyrimidine-5-carboxylic acid.
| Compound Name | 4-[(2,6-dichloro-3-pyridinyl)methylsulfanyl]-2,6-dimethylpyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 106993392 |
| Molecular Formula | C13H11Cl2N3O2S |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 342.99 |
| IUPAC Name | 4-[(2,6-dichloro-3-pyridinyl)methylsulfanyl]-2,6-dimethylpyrimidine-5-carboxylic acid |
| SMILES | Cc1nc(C)c(C(=O)O)c(SCc2ccc(Cl)nc2Cl)n1 |
| InChI | InChI=1S/C13H11Cl2N3O2S/c1-6-10(13(19)20)12(17-7(2)16-6)21-5-8-3-4-9(14)18-11(8)15/h3-4H,5H2,1-2H3,(H,19,20) |
| InChIKey | MTYPHJLJPAKYNW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|