C11H10Cl2N2OS — CID 106994174
3-[(2,6-dichloro-3-pyridinyl)methyl]-4,5-dimethyl-1,3-thiazol-2-one (PubChem CID 106994174) has the molecular formula C11H10Cl2N2OS and a molecular weight of 289.19 g/mol. Its IUPAC name is 3-[(2,6-dichloro-3-pyridinyl)methyl]-4,5-dimethyl-1,3-thiazol-2-one.
| Compound Name | 3-[(2,6-dichloro-3-pyridinyl)methyl]-4,5-dimethyl-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106994174 |
| Molecular Formula | C11H10Cl2N2OS |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 3-[(2,6-dichloro-3-pyridinyl)methyl]-4,5-dimethyl-1,3-thiazol-2-one |
| SMILES | Cc1sc(=O)n(Cc2ccc(Cl)nc2Cl)c1C |
| InChI | InChI=1S/C11H10Cl2N2OS/c1-6-7(2)17-11(16)15(6)5-8-3-4-9(12)14-10(8)13/h3-4H,5H2,1-2H3 |
| InChIKey | ZTJMEGAEIXFLFF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|