C9H6Cl2IN3 — CID 106994202
2,6-dichloro-3-[(4-iodopyrazol-1-yl)methyl]pyridine (PubChem CID 106994202) has the molecular formula C9H6Cl2IN3 and a molecular weight of 353.98 g/mol. Its IUPAC name is 2,6-dichloro-3-[(4-iodopyrazol-1-yl)methyl]pyridine.
| Compound Name | 2,6-dichloro-3-[(4-iodopyrazol-1-yl)methyl]pyridine |
|---|---|
| PubChem CID | 106994202 |
| Molecular Formula | C9H6Cl2IN3 |
| Molecular Weight | 353.98 g/mol |
| Exact Mass | 352.90 |
| IUPAC Name | 2,6-dichloro-3-[(4-iodopyrazol-1-yl)methyl]pyridine |
| SMILES | Clc1ccc(Cn2cc(I)cn2)c(Cl)n1 |
| InChI | InChI=1S/C9H6Cl2IN3/c10-8-2-1-6(9(11)14-8)4-15-5-7(12)3-13-15/h1-3,5H,4H2 |
| InChIKey | RLCPBYCARLYLJF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.98 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|