About 3-[(2,6-dichloro-3-pyridinyl)methyl]-1,3-benzothiazine-2,4-dione
3-[(2,6-dichloro-3-pyridinyl)methyl]-1,3-benzothiazine-2,4-dione (PubChem CID 106994285) has the molecular formula C14H8Cl2N2O2S
and a molecular weight of 339.20 g/mol. Its IUPAC name is 3-[(2,6-dichloro-3-pyridinyl)methyl]-1,3-benzothiazine-2,4-dione.
Molecular Properties
| Compound Name | 3-[(2,6-dichloro-3-pyridinyl)methyl]-1,3-benzothiazine-2,4-dione |
| PubChem CID | 106994285 |
| Molecular Formula | C14H8Cl2N2O2S |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 337.97 |
| IUPAC Name | 3-[(2,6-dichloro-3-pyridinyl)methyl]-1,3-benzothiazine-2,4-dione |
| SMILES | O=c1sc2ccccc2c(=O)n1Cc1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C14H8Cl2N2O2S/c15-11-6-5-8(12(16)17-11)7-18-13(19)9-3-1-2-4-10(9)21-14(18)20/h1-6H,7H2 |
| InChIKey | ORXFMXFEOASREL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2,6-dichloro-3-pyridinyl)methyl]-1,3-benzothiazine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,6-dichloro-3-pyridinyl)methyl]-1,3-benzothiazine-2,4-dione?
The IUPAC name of 3-[(2,6-dichloro-3-pyridinyl)methyl]-1,3-benzothiazine-2,4-dione (CID 106994285) is 3-[(2,6-dichloro-3-pyridinyl)methyl]-1,3-benzothiazine-2,4-dione.
What is the SMILES notation for 3-[(2,6-dichloro-3-pyridinyl)methyl]-1,3-benzothiazine-2,4-dione?
The canonical SMILES for 3-[(2,6-dichloro-3-pyridinyl)methyl]-1,3-benzothiazine-2,4-dione is O=c1sc2ccccc2c(=O)n1Cc1ccc(Cl)nc1Cl.
What is the InChIKey of 3-[(2,6-dichloro-3-pyridinyl)methyl]-1,3-benzothiazine-2,4-dione?
The InChIKey is ORXFMXFEOASREL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8Cl2N2O2S/c15-11-6-5-8(12(16)17-11)7-18-13(19)9-3-1-2-4-10(9)21-14(18)20/h1-6H,7H2.
What are the key properties of 3-[(2,6-dichloro-3-pyridinyl)methyl]-1,3-benzothiazine-2,4-dione?
3-[(2,6-dichloro-3-pyridinyl)methyl]-1,3-benzothiazine-2,4-dione has a molecular weight of 339.20 g/mol, XLogP of 3.17, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,6-dichloro-3-pyridinyl)methyl]-1,3-benzothiazine-2,4-dione is sourced from PubChem (CID 106994285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).