C9H7Cl2F4NO — CID 106994494
2,6-dichloro-3-(2,2,3,3-tetrafluoropropoxymethyl)pyridine (PubChem CID 106994494) has the molecular formula C9H7Cl2F4NO and a molecular weight of 292.06 g/mol. Its IUPAC name is 2,6-dichloro-3-(2,2,3,3-tetrafluoropropoxymethyl)pyridine.
| Compound Name | 2,6-dichloro-3-(2,2,3,3-tetrafluoropropoxymethyl)pyridine |
|---|---|
| PubChem CID | 106994494 |
| Molecular Formula | C9H7Cl2F4NO |
| Molecular Weight | 292.06 g/mol |
| Exact Mass | 290.98 |
| IUPAC Name | 2,6-dichloro-3-(2,2,3,3-tetrafluoropropoxymethyl)pyridine |
| SMILES | FC(F)C(F)(F)COCc1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C9H7Cl2F4NO/c10-6-2-1-5(7(11)16-6)3-17-4-9(14,15)8(12)13/h1-2,8H,3-4H2 |
| InChIKey | ZVQKIDVLNXVMST-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.06 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|