C14H21Cl2N3O — CID 106994993
N-[(2,6-dichloro-3-pyridinyl)methyl]-2-methoxy-N-(pyrrolidin-2-ylmethyl)ethanamine (PubChem CID 106994993) has the molecular formula C14H21Cl2N3O and a molecular weight of 318.25 g/mol. Its IUPAC name is N-[(2,6-dichloro-3-pyridinyl)methyl]-2-methoxy-N-(pyrrolidin-2-ylmethyl)ethanamine.
| Compound Name | N-[(2,6-dichloro-3-pyridinyl)methyl]-2-methoxy-N-(pyrrolidin-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 106994993 |
| Molecular Formula | C14H21Cl2N3O |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | N-[(2,6-dichloro-3-pyridinyl)methyl]-2-methoxy-N-(pyrrolidin-2-ylmethyl)ethanamine |
| SMILES | COCCN(Cc1ccc(Cl)nc1Cl)CC1CCCN1 |
| InChI | InChI=1S/C14H21Cl2N3O/c1-20-8-7-19(10-12-3-2-6-17-12)9-11-4-5-13(15)18-14(11)16/h4-5,12,17H,2-3,6-10H2,1H3 |
| InChIKey | TXXGYDIGSXSQKC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|