C16H24N2O — CID 106995354
2-(3,4-dimethylphenyl)-N-(2-methylpiperidin-4-yl)acetamide (PubChem CID 106995354) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-N-(2-methylpiperidin-4-yl)acetamide.
| Compound Name | 2-(3,4-dimethylphenyl)-N-(2-methylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 106995354 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-N-(2-methylpiperidin-4-yl)acetamide |
| SMILES | Cc1ccc(CC(=O)NC2CCNC(C)C2)cc1C |
| InChI | InChI=1S/C16H24N2O/c1-11-4-5-14(8-12(11)2)10-16(19)18-15-6-7-17-13(3)9-15/h4-5,8,13,15,17H,6-7,9-10H2,1-3H3,(H,18,19) |
| InChIKey | JQRXGOKCRMVXOA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |