C13H17IN2O — CID 106995591
2-iodo-N-(2-methylpiperidin-4-yl)benzamide (PubChem CID 106995591) has the molecular formula C13H17IN2O and a molecular weight of 344.20 g/mol. Its IUPAC name is 2-iodo-N-(2-methylpiperidin-4-yl)benzamide.
| Compound Name | 2-iodo-N-(2-methylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 106995591 |
| Molecular Formula | C13H17IN2O |
| Molecular Weight | 344.20 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 2-iodo-N-(2-methylpiperidin-4-yl)benzamide |
| SMILES | CC1CC(NC(=O)c2ccccc2I)CCN1 |
| InChI | InChI=1S/C13H17IN2O/c1-9-8-10(6-7-15-9)16-13(17)11-4-2-3-5-12(11)14/h2-5,9-10,15H,6-8H2,1H3,(H,16,17) |
| InChIKey | BHYSLRCFUXDNQF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.20 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|