C10H17N3O2S — CID 106995654
N-(2-methylpiperidin-4-yl)-1H-pyrrole-3-sulfonamide (PubChem CID 106995654) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is N-(2-methylpiperidin-4-yl)-1H-pyrrole-3-sulfonamide.
| Compound Name | N-(2-methylpiperidin-4-yl)-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106995654 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | N-(2-methylpiperidin-4-yl)-1H-pyrrole-3-sulfonamide |
| SMILES | CC1CC(NS(=O)(=O)c2cc[nH]c2)CCN1 |
| InChI | InChI=1S/C10H17N3O2S/c1-8-6-9(2-5-12-8)13-16(14,15)10-3-4-11-7-10/h3-4,7-9,11-13H,2,5-6H2,1H3 |
| InChIKey | XLYWJNJPCOQKMA-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |