About 2-methyl-N-(2,2,2-trifluoroethylsulfamoyl)piperidin-4-amine
2-methyl-N-(2,2,2-trifluoroethylsulfamoyl)piperidin-4-amine (PubChem CID 106995784) has the molecular formula C8H16F3N3O2S
and a molecular weight of 275.30 g/mol. Its IUPAC name is 2-methyl-N-(2,2,2-trifluoroethylsulfamoyl)piperidin-4-amine.
Molecular Properties
| Compound Name | 2-methyl-N-(2,2,2-trifluoroethylsulfamoyl)piperidin-4-amine |
| PubChem CID | 106995784 |
| Molecular Formula | C8H16F3N3O2S |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 2-methyl-N-(2,2,2-trifluoroethylsulfamoyl)piperidin-4-amine |
| SMILES | CC1CC(NS(=O)(=O)NCC(F)(F)F)CCN1 |
| InChI | InChI=1S/C8H16F3N3O2S/c1-6-4-7(2-3-12-6)14-17(15,16)13-5-8(9,10)11/h6-7,12-14H,2-5H2,1H3 |
| InChIKey | NHVOCZNJTAZPCM-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-N-(2,2,2-trifluoroethylsulfamoyl)piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-(2,2,2-trifluoroethylsulfamoyl)piperidin-4-amine?
The IUPAC name of 2-methyl-N-(2,2,2-trifluoroethylsulfamoyl)piperidin-4-amine (CID 106995784) is 2-methyl-N-(2,2,2-trifluoroethylsulfamoyl)piperidin-4-amine.
What is the SMILES notation for 2-methyl-N-(2,2,2-trifluoroethylsulfamoyl)piperidin-4-amine?
The canonical SMILES for 2-methyl-N-(2,2,2-trifluoroethylsulfamoyl)piperidin-4-amine is CC1CC(NS(=O)(=O)NCC(F)(F)F)CCN1.
What is the InChIKey of 2-methyl-N-(2,2,2-trifluoroethylsulfamoyl)piperidin-4-amine?
The InChIKey is NHVOCZNJTAZPCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F3N3O2S/c1-6-4-7(2-3-12-6)14-17(15,16)13-5-8(9,10)11/h6-7,12-14H,2-5H2,1H3.
What are the key properties of 2-methyl-N-(2,2,2-trifluoroethylsulfamoyl)piperidin-4-amine?
2-methyl-N-(2,2,2-trifluoroethylsulfamoyl)piperidin-4-amine has a molecular weight of 275.30 g/mol, XLogP of 0.11, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-(2,2,2-trifluoroethylsulfamoyl)piperidin-4-amine is sourced from PubChem (CID 106995784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).